|
HS Code |
941606 |
| Productname | 1-Butyl-2,3-Dimethylimidazolium Bis(Trifluoromethylsulfonyl)Amine |
| Casnumber | 174899-82-2 |
| Molecularformula | C13H22F6N4O4S2 |
| Molecularweight | 512.46 |
| Appearance | Colorless to pale yellow liquid |
| Meltingpoint | -11 °C |
| Boilingpoint | Decomposes before boiling |
| Density | 1.387 g/cm3 (at 25 °C) |
| Solubilityinwater | Miscible |
| Purity | Typically ≥99% |
| Smiles | CCCCn1c(nc(c1C)C)[N+](C)(C).[N-](SO2CF3)2 |
| Iupacname | 1-butyl-2,3-dimethylimidazol-3-ium bis(trifluoromethanesulfonyl)azanide |
| Refractiveindex | 1.420 (at 20 °C) |
| Storagetemperature | Room temperature, tightly closed |
| Ecnumber | None assigned |
As an accredited 1-Butyl-2,3-Dimethylimidazolium Bis(Trifluoromethylsulfonyl)Amine factory, we enforce strict quality protocols—every batch undergoes rigorous testing to ensure consistent efficacy and safety standards.
| Packing | Supplied in a 100 mL amber glass bottle, tightly sealed, with hazard labels, chemical name, and handling instructions clearly printed. |
| Storage | 1-Butyl-2,3-Dimethylimidazolium Bis(Trifluoromethylsulfonyl)Amine should be stored in a cool, dry, and well-ventilated area, away from moisture and incompatible materials such as strong oxidizers. Keep the container tightly closed when not in use. Store at ambient temperature, protected from direct sunlight. Ensure appropriate labeling and use secondary containment to prevent accidental spillage or leaks. |
| Shipping | **Shipping Description:** 1-Butyl-2,3-dimethylimidazolium bis(trifluoromethylsulfonyl)amine is typically shipped in sealed, chemical-resistant containers, protected from moisture and light. Comply with all relevant hazardous materials regulations. Label containers appropriately. During transit, secure upright and avoid temperature extremes. Consult the SDS for specific transportation codes and ensure documentation accompanies the shipment as per regulatory requirements. |
Competitive 1-Butyl-2,3-Dimethylimidazolium Bis(Trifluoromethylsulfonyl)Amine prices that fit your budget—flexible terms and customized quotes for every order.
For samples, pricing, or more information, please contact us at +8615380400285 or mail to sales2@quaternary-ammonium-salt.com.
We will respond to you as soon as possible.
Tel: +8615380400285
